C27H33ClN2O7 — CID 138459573
(4aS,12aR)-7-chloro-8-[[ethyl(2-methylbutan-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 138459573) has the molecular formula C27H33ClN2O7 and a molecular weight of 533.02 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-8-[[ethyl(2-methylbutan-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-8-[[ethyl(2-methylbutan-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138459573 |
| Molecular Formula | C27H33ClN2O7 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (4aS,12aR)-7-chloro-8-[[ethyl(2-methylbutan-2-yl)amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(Cc1cc(O)c2c(c1Cl)CC1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)C(C)(C)CC |
| InChI | InChI=1S/C27H33ClN2O7/c1-5-26(3,4)30(6-2)11-13-9-16(31)19-15(21(13)28)8-12-7-14-10-17(32)20(25(29)36)24(35)27(14,37)23(34)18(12)22(19)33/h9,12,14,31,33,35,37H,5-8,10-11H2,1-4H3,(H2,29,36)/t12?,14-,27-/m0/s1 |
| InChIKey | KJWOMJAQEOLIJA-MTSCWLGPSA-N |
| XLogP | 3.09 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|