C29H27ClN2O8 — CID 126598138
(4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126598138) has the molecular formula C29H27ClN2O8 and a molecular weight of 566.99 g/mol. Its IUPAC name is (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126598138 |
| Molecular Formula | C29H27ClN2O8 |
| Molecular Weight | 566.99 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (4aS,12aR)-7-chloro-1,10,11,12a-tetrahydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc2c(c1)CN(Cc1cc(O)c3c(c1Cl)CC1C[C@H]4CC(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C1=C3O)C2 |
| InChI | InChI=1S/C29H27ClN2O8/c1-40-17-3-2-12-9-32(10-14(12)5-17)11-15-7-19(33)22-18(24(15)30)6-13-4-16-8-20(34)23(28(31)38)27(37)29(16,39)26(36)21(13)25(22)35/h2-3,5,7,13,16,33,35,37,39H,4,6,8-11H2,1H3,(H2,31,38)/t13?,16-,29-/m0/s1 |
| InChIKey | VHWBGCPGKNFSPD-UHZUVEPISA-N |
| XLogP | 2.60 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.99 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|