C26H23FN2O9S — CID 126597965
(4aS,12aR)-8-(benzenesulfonamidomethyl)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126597965) has the molecular formula C26H23FN2O9S and a molecular weight of 558.54 g/mol. Its IUPAC name is (4aS,12aR)-8-(benzenesulfonamidomethyl)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-(benzenesulfonamidomethyl)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126597965 |
| Molecular Formula | C26H23FN2O9S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | (4aS,12aR)-8-(benzenesulfonamidomethyl)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CNS(=O)(=O)c5ccccc5)c(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C26H23FN2O9S/c27-21-12(10-29-39(37,38)14-4-2-1-3-5-14)8-16(30)19-15(21)7-11-6-13-9-17(31)20(25(28)35)24(34)26(13,36)23(33)18(11)22(19)32/h1-5,8,11,13,29-30,32,34,36H,6-7,9-10H2,(H2,28,35)/t11?,13-,26-/m0/s1 |
| InChIKey | XKECSZKXXSRVGU-GUTOZKJFSA-N |
| XLogP | 1.04 |
| TPSA | 204.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|