C30H35FN2O7 — CID 126597744
(4aS,12aR)-8-[[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126597744) has the molecular formula C30H35FN2O7 and a molecular weight of 554.62 g/mol. Its IUPAC name is (4aS,12aR)-8-[[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-8-[[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126597744 |
| Molecular Formula | C30H35FN2O7 |
| Molecular Weight | 554.62 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (4aS,12aR)-8-[[[(2S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylamino]methyl]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1(C)C2CC[C@H](CNCc3cc(O)c4c(c3F)CC3C[C@H]5CC(=O)C(C(N)=O)=C(O)[C@@]5(O)C(=O)C3=C4O)C1C2 |
| InChI | InChI=1S/C30H35FN2O7/c1-29(2)15-4-3-12(18(29)8-15)10-33-11-14-7-19(34)22-17(24(14)31)6-13-5-16-9-20(35)23(28(32)39)27(38)30(16,40)26(37)21(13)25(22)36/h7,12-13,15-16,18,33-34,36,38,40H,3-6,8-11H2,1-2H3,(H2,32,39)/t12-,13?,15?,16+,18?,30+/m1/s1 |
| InChIKey | QRXQAGUOJGKBHJ-OHRLAKTGSA-N |
| XLogP | 2.72 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|