C26H28FN3O8 — CID 126596668
1-[[(6aR,10aS)-8-carbamoyl-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 126596668) has the molecular formula C26H28FN3O8 and a molecular weight of 529.52 g/mol. Its IUPAC name is 1-[[(6aR,10aS)-8-carbamoyl-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[(6aR,10aS)-8-carbamoyl-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126596668 |
| Molecular Formula | C26H28FN3O8 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 1-[[(6aR,10aS)-8-carbamoyl-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CN5CCC(C(N)=O)CC5)c(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C26H28FN3O8/c27-20-12(9-30-3-1-10(2-4-30)24(28)36)7-15(31)18-14(20)6-11-5-13-8-16(32)19(25(29)37)23(35)26(13,38)22(34)17(11)21(18)33/h7,10-11,13,31,33,35,38H,1-6,8-9H2,(H2,28,36)(H2,29,37)/t11?,13-,26-/m0/s1 |
| InChIKey | LCEFEUAOOIOKAV-GUTOZKJFSA-N |
| XLogP | 0.26 |
| TPSA | 204.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|