C31H32FN3O7 — CID 167335779
(4S,4aS,5aR,12aR)-4-amino-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-[(4-phenylpiperidin-1-yl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167335779) has the molecular formula C31H32FN3O7 and a molecular weight of 577.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-amino-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-[(4-phenylpiperidin-1-yl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-amino-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-[(4-phenylpiperidin-1-yl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167335779 |
| Molecular Formula | C31H32FN3O7 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-amino-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-[(4-phenylpiperidin-1-yl)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CN5CCC(c6ccccc6)CC5)c(F)c4C[C@H]3C[C@H]2[C@H](N)C1=O |
| InChI | InChI=1S/C31H32FN3O7/c32-24-17(13-35-8-6-15(7-9-35)14-4-2-1-3-5-14)12-20(36)22-18(24)10-16-11-19-25(33)27(38)23(30(34)41)29(40)31(19,42)28(39)21(16)26(22)37/h1-5,12,15-16,19,25,36-37,40,42H,6-11,13,33H2,(H2,34,41)/t16-,19-,25-,31-/m0/s1 |
| InChIKey | BMOHJBSPPDNPBH-QAEYPGILSA-N |
| XLogP | 1.88 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|