C28H35N3O8 — CID 167335808
(4S,4aS,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-methoxy-8-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167335808) has the molecular formula C28H35N3O8 and a molecular weight of 541.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-methoxy-8-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-methoxy-8-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167335808 |
| Molecular Formula | C28H35N3O8 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-amino-1,10,11,12a-tetrahydroxy-7-methoxy-8-[(2S)-1-(2-methylpropyl)pyrrolidin-2-yl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1c([C@@H]2CCCN2CC(C)C)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H35N3O8/c1-11(2)10-31-6-4-5-16(31)13-9-17(32)19-14(24(13)39-3)7-12-8-15-21(29)23(34)20(27(30)37)26(36)28(15,38)25(35)18(12)22(19)33/h9,11-12,15-16,21,32-33,36,38H,4-8,10,29H2,1-3H3,(H2,30,37)/t12-,15-,16-,21-,28-/m0/s1 |
| InChIKey | IGJNFSMLLOMBSC-MEKZYAFBSA-N |
| XLogP | 1.16 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|