C26H31N3O8 — CID 167335847
(4R,4aR,5aS,12aS)-4-amino-8-[(2R)-1-ethylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167335847) has the molecular formula C26H31N3O8 and a molecular weight of 513.55 g/mol. Its IUPAC name is (4R,4aR,5aS,12aS)-4-amino-8-[(2R)-1-ethylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aS,12aS)-4-amino-8-[(2R)-1-ethylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167335847 |
| Molecular Formula | C26H31N3O8 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (4R,4aR,5aS,12aS)-4-amino-8-[(2R)-1-ethylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN1CCC[C@@H]1c1cc(O)c2c(c1OC)C[C@@H]1C[C@@H]3[C@@H](N)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C26H31N3O8/c1-3-29-6-4-5-14(29)11-9-15(30)17-12(22(11)37-2)7-10-8-13-19(27)21(32)18(25(28)35)24(34)26(13,36)23(33)16(10)20(17)31/h9-10,13-14,19,30-31,34,36H,3-8,27H2,1-2H3,(H2,28,35)/t10-,13-,14-,19-,26-/m1/s1 |
| InChIKey | OLTNQCKDPZMTLV-ZVOQHPIJSA-N |
| XLogP | 0.53 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|