C29H37N3O8 — CID 67818854
(4S,4aS,5aR,12aR)-8-[(2-cyclopropylpropan-2-ylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67818854) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[(2-cyclopropylpropan-2-ylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[(2-cyclopropylpropan-2-ylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67818854 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[(2-cyclopropylpropan-2-ylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1c(CNC(C)(C)C2CC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H37N3O8/c1-28(2,14-6-7-14)31-11-13-10-17(33)19-15(24(13)40-5)8-12-9-16-21(32(3)4)23(35)20(27(30)38)26(37)29(16,39)25(36)18(12)22(19)34/h10,12,14,16,21,31,33-34,37,39H,6-9,11H2,1-5H3,(H2,30,38)/t12-,16-,21-,29-/m0/s1 |
| InChIKey | HVQHFVVYYFBHCF-AQNMVOFKSA-N |
| XLogP | 1.25 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|