C31H43N3O8 — CID 67815606
(4S,4aS,5aR,12aR)-4-(dimethylamino)-8-[[3,3-dimethylbutyl(ethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67815606) has the molecular formula C31H43N3O8 and a molecular weight of 585.70 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-8-[[3,3-dimethylbutyl(ethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-8-[[3,3-dimethylbutyl(ethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67815606 |
| Molecular Formula | C31H43N3O8 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-8-[[3,3-dimethylbutyl(ethyl)amino]methyl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(CCC(C)(C)C)Cc1cc(O)c2c(c1OC)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H43N3O8/c1-8-34(10-9-30(2,3)4)14-16-13-19(35)21-17(26(16)42-7)11-15-12-18-23(33(5)6)25(37)22(29(32)40)28(39)31(18,41)27(38)20(15)24(21)36/h13,15,18,23,35-36,39,41H,8-12,14H2,1-7H3,(H2,32,40)/t15-,18-,23-,31-/m0/s1 |
| InChIKey | PEQUXFDVUHCCLZ-AIZPGUGSSA-N |
| XLogP | 2.23 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|