C29H39N3O9 — CID 67815508
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-8-[[methyl(2-propan-2-yloxyethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67815508) has the molecular formula C29H39N3O9 and a molecular weight of 573.64 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-8-[[methyl(2-propan-2-yloxyethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-8-[[methyl(2-propan-2-yloxyethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67815508 |
| Molecular Formula | C29H39N3O9 |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-methoxy-8-[[methyl(2-propan-2-yloxyethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1c(CN(C)CCOC(C)C)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H39N3O9/c1-13(2)41-8-7-32(5)12-15-11-18(33)20-16(25(15)40-6)9-14-10-17-22(31(3)4)24(35)21(28(30)38)27(37)29(17,39)26(36)19(14)23(20)34/h11,13-14,17,22,33-34,37,39H,7-10,12H2,1-6H3,(H2,30,38)/t14-,17-,22-,29-/m0/s1 |
| InChIKey | DYCGXQGTHSXYRF-APUYUXPVSA-N |
| XLogP | 0.83 |
| TPSA | 183.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|