C30H42N4O7 — CID 67816619
(4S,4aS,5aR,12aR)-8-[[tert-butyl(ethyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67816619) has the molecular formula C30H42N4O7 and a molecular weight of 570.69 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[[tert-butyl(ethyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[[tert-butyl(ethyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67816619 |
| Molecular Formula | C30H42N4O7 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[[tert-butyl(ethyl)amino]methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(Cc1cc(O)c2c(c1N(C)C)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)C(C)(C)C |
| InChI | InChI=1S/C30H42N4O7/c1-9-34(29(2,3)4)13-15-12-18(35)20-16(22(15)32(5)6)10-14-11-17-23(33(7)8)25(37)21(28(31)40)27(39)30(17,41)26(38)19(14)24(20)36/h12,14,17,23,35-36,39,41H,9-11,13H2,1-8H3,(H2,31,40)/t14-,17-,23-,30-/m0/s1 |
| InChIKey | WQYMFRKFRPZVRO-ALDKRDSJSA-N |
| XLogP | 1.65 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|