C33H46N4O7 — CID 67816693
(4S,4aS,5aR,12aR)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67816693) has the molecular formula C33H46N4O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67816693 |
| Molecular Formula | C33H46N4O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[(4-tert-butylpiperidin-1-yl)methyl]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1c(CN2CCC(C(C)(C)C)CC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C33H46N4O7/c1-32(2,3)18-8-10-37(11-9-18)15-17-14-21(38)23-19(25(17)35(4)5)12-16-13-20-26(36(6)7)28(40)24(31(34)43)30(42)33(20,44)29(41)22(16)27(23)39/h14,16,18,20,26,38-39,42,44H,8-13,15H2,1-7H3,(H2,34,43)/t16-,20-,26-,33-/m0/s1 |
| InChIKey | DZHMOSLYVPAIFV-LICIYYCLSA-N |
| XLogP | 2.29 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|