C30H40N4O8 — CID 67816632
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-8-[[ethyl-[(3R)-oxolan-3-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67816632) has the molecular formula C30H40N4O8 and a molecular weight of 584.67 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-8-[[ethyl-[(3R)-oxolan-3-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-8-[[ethyl-[(3R)-oxolan-3-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67816632 |
| Molecular Formula | C30H40N4O8 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-8-[[ethyl-[(3R)-oxolan-3-yl]amino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(Cc1cc(O)c2c(c1N(C)C)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)[C@@H]1CCOC1 |
| InChI | InChI=1S/C30H40N4O8/c1-6-34(16-7-8-42-13-16)12-15-11-19(35)21-17(23(15)32(2)3)9-14-10-18-24(33(4)5)26(37)22(29(31)40)28(39)30(18,41)27(38)20(14)25(21)36/h11,14,16,18,24,35-36,39,41H,6-10,12-13H2,1-5H3,(H2,31,40)/t14-,16+,18-,24-,30-/m0/s1 |
| InChIKey | FGICFUIHTQVRPE-XWUPCDSESA-N |
| XLogP | 0.64 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|