C28H34FN3O8 — CID 67813276
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[[methyl(oxolan-3-ylmethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67813276) has the molecular formula C28H34FN3O8 and a molecular weight of 559.59 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[[methyl(oxolan-3-ylmethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[[methyl(oxolan-3-ylmethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67813276 |
| Molecular Formula | C28H34FN3O8 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[[methyl(oxolan-3-ylmethyl)amino]methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(Cc1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC1CCOC1 |
| InChI | InChI=1S/C28H34FN3O8/c1-31(2)22-16-7-13-6-15-19(17(33)8-14(21(15)29)10-32(3)9-12-4-5-40-11-12)23(34)18(13)25(36)28(16,39)26(37)20(24(22)35)27(30)38/h8,12-13,16,22,33-34,37,39H,4-7,9-11H2,1-3H3,(H2,30,38)/t12?,13-,16-,22-,28-/m0/s1 |
| InChIKey | CYPHRPVRJAPCPE-IZYGHUPTSA-N |
| XLogP | 0.57 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|