C33H44FN3O7 — CID 67814821
(4S,4aS,5aR,12aR)-8-[[cycloheptylmethyl(propyl)amino]methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67814821) has the molecular formula C33H44FN3O7 and a molecular weight of 613.73 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[[cycloheptylmethyl(propyl)amino]methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[[cycloheptylmethyl(propyl)amino]methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67814821 |
| Molecular Formula | C33H44FN3O7 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[[cycloheptylmethyl(propyl)amino]methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCN(Cc1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)CC1CCCCCC1 |
| InChI | InChI=1S/C33H44FN3O7/c1-4-11-37(15-17-9-7-5-6-8-10-17)16-19-14-22(38)24-20(26(19)34)12-18-13-21-27(36(2)3)29(40)25(32(35)43)31(42)33(21,44)30(41)23(18)28(24)39/h14,17-18,21,27,38-39,42,44H,4-13,15-16H2,1-3H3,(H2,35,43)/t18-,21-,27-,33-/m0/s1 |
| InChIKey | BAWRTXMXWJHXBA-MQKOLEJSSA-N |
| XLogP | 3.29 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|