C26H34Cl2FN3O7 — CID 72713006
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[(2-methylpropylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride (PubChem CID 72713006) has the molecular formula C26H34Cl2FN3O7 and a molecular weight of 590.48 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[(2-methylpropylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[(2-methylpropylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 72713006 |
| Molecular Formula | C26H34Cl2FN3O7 |
| Molecular Weight | 590.48 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-[(2-methylpropylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
| SMILES | CC(C)CNCc1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.Cl.Cl |
| InChI | InChI=1S/C26H32FN3O7.2ClH/c1-10(2)8-29-9-12-7-15(31)17-13(19(12)27)5-11-6-14-20(30(3)4)22(33)18(25(28)36)24(35)26(14,37)23(34)16(11)21(17)32;;/h7,10-11,14,20,29,31-32,35,37H,5-6,8-9H2,1-4H3,(H2,28,36);2*1H/t11-,14-,20-,26-;;/m0../s1 |
| InChIKey | VCZYUXNDCWHDNK-FZDUZBSDSA-N |
| XLogP | 1.69 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|