C30H38ClN3O7 — CID 67815682
(4S,4aS,5aR,12aR)-7-chloro-8-[(cycloheptylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67815682) has the molecular formula C30H38ClN3O7 and a molecular weight of 588.10 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-chloro-8-[(cycloheptylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-chloro-8-[(cycloheptylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67815682 |
| Molecular Formula | C30H38ClN3O7 |
| Molecular Weight | 588.10 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-chloro-8-[(cycloheptylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CNCC5CCCCCC5)c(Cl)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H38ClN3O7/c1-34(2)24-18-10-15-9-17-21(19(35)11-16(23(17)31)13-33-12-14-7-5-3-4-6-8-14)25(36)20(15)27(38)30(18,41)28(39)22(26(24)37)29(32)40/h11,14-15,18,24,33,35-36,39,41H,3-10,12-13H2,1-2H3,(H2,32,40)/t15-,18-,24-,30-/m0/s1 |
| InChIKey | YAMIBJJMSRWRRI-JOSRSFNQSA-N |
| XLogP | 2.68 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.10 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|