C29H34F3N3O7 — CID 67817440
(4S,4aS,5aR,12aR)-8-[(cyclopentylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67817440) has the molecular formula C29H34F3N3O7 and a molecular weight of 593.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[(cyclopentylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[(cyclopentylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67817440 |
| Molecular Formula | C29H34F3N3O7 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[(cyclopentylmethylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CNCC5CCCC5)c(C(F)(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H34F3N3O7/c1-35(2)22-16-8-13-7-15-19(23(37)18(13)25(39)28(16,42)26(40)20(24(22)38)27(33)41)17(36)9-14(21(15)29(30,31)32)11-34-10-12-5-3-4-6-12/h9,12-13,16,22,34,36-37,40,42H,3-8,10-11H2,1-2H3,(H2,33,41)/t13-,16-,22-,28-/m0/s1 |
| InChIKey | KWWSYBJCASDHRR-NCSQOUBWSA-N |
| XLogP | 2.26 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|