C27H30F3N3O7 — CID 67815880
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-8-[(3-methylazetidin-1-yl)methyl]-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67815880) has the molecular formula C27H30F3N3O7 and a molecular weight of 565.55 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-8-[(3-methylazetidin-1-yl)methyl]-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-8-[(3-methylazetidin-1-yl)methyl]-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67815880 |
| Molecular Formula | C27H30F3N3O7 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-8-[(3-methylazetidin-1-yl)methyl]-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1CN(Cc2cc(O)c3c(c2C(F)(F)F)C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)C1 |
| InChI | InChI=1S/C27H30F3N3O7/c1-10-7-33(8-10)9-12-6-15(34)17-13(19(12)27(28,29)30)4-11-5-14-20(32(2)3)22(36)18(25(31)39)24(38)26(14,40)23(37)16(11)21(17)35/h6,10-11,14,20,34-35,38,40H,4-5,7-9H2,1-3H3,(H2,31,39)/t11-,14-,20-,26-/m0/s1 |
| InChIKey | HPSMCZOCPLLXPQ-INJPKEBHSA-N |
| XLogP | 1.43 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|