C23H28Cl2FN3O7 — CID 72713869
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(methylaminomethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride (PubChem CID 72713869) has the molecular formula C23H28Cl2FN3O7 and a molecular weight of 548.40 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(methylaminomethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(methylaminomethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 72713869 |
| Molecular Formula | C23H28Cl2FN3O7 |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-8-(methylaminomethyl)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;dihydrochloride |
| SMILES | CNCc1cc(O)c2c(c1F)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.Cl.Cl |
| InChI | InChI=1S/C23H26FN3O7.2ClH/c1-26-7-9-6-12(28)14-10(16(9)24)4-8-5-11-17(27(2)3)19(30)15(22(25)33)21(32)23(11,34)20(31)13(8)18(14)29;;/h6,8,11,17,26,28-29,32,34H,4-5,7H2,1-3H3,(H2,25,33);2*1H/t8-,11-,17-,23-;;/m0../s1 |
| InChIKey | FQTHCURBPDZBQF-DYQPLIPDSA-N |
| XLogP | 0.67 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|