C33H40FN3O7 — CID 67816984
(4S,4aS,5aR,12aR)-8-[(1-adamantylmethylamino)methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67816984) has the molecular formula C33H40FN3O7 and a molecular weight of 609.70 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[(1-adamantylmethylamino)methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[(1-adamantylmethylamino)methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67816984 |
| Molecular Formula | C33H40FN3O7 |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[(1-adamantylmethylamino)methyl]-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(CNCC56CC7CC(CC(C7)C5)C6)c(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C33H40FN3O7/c1-37(2)26-20-7-17-6-19-23(27(39)22(17)29(41)33(20,44)30(42)24(28(26)40)31(35)43)21(38)8-18(25(19)34)12-36-13-32-9-14-3-15(10-32)5-16(4-14)11-32/h8,14-17,20,26,36,38-39,42,44H,3-7,9-13H2,1-2H3,(H2,35,43)/t14?,15?,16?,17-,20-,26-,32?,33-/m0/s1 |
| InChIKey | OAKDMAKGEHUAPF-RVRMAVDDSA-N |
| XLogP | 2.41 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|