C29H36ClN3O7 — CID 67815529
(4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[[(1-ethylcyclobutyl)methylamino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67815529) has the molecular formula C29H36ClN3O7 and a molecular weight of 574.07 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[[(1-ethylcyclobutyl)methylamino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[[(1-ethylcyclobutyl)methylamino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67815529 |
| Molecular Formula | C29H36ClN3O7 |
| Molecular Weight | 574.07 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[[(1-ethylcyclobutyl)methylamino]methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCC1(CNCc2cc(O)c3c(c2Cl)C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)CCC1 |
| InChI | InChI=1S/C29H36ClN3O7/c1-4-28(6-5-7-28)12-32-11-14-10-17(34)19-15(21(14)30)8-13-9-16-22(33(2)3)24(36)20(27(31)39)26(38)29(16,40)25(37)18(13)23(19)35/h10,13,16,22,32,34-35,38,40H,4-9,11-12H2,1-3H3,(H2,31,39)/t13-,16-,22-,29-/m0/s1 |
| InChIKey | MUTZQMJTQPJCOM-LLESYXQASA-N |
| XLogP | 2.29 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.07 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|