C27H31ClFN3O7 — CID 56836289
(4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[1-(2-fluoroethyl)pyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 56836289) has the molecular formula C27H31ClFN3O7 and a molecular weight of 564.01 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[1-(2-fluoroethyl)pyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[1-(2-fluoroethyl)pyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 56836289 |
| Molecular Formula | C27H31ClFN3O7 |
| Molecular Weight | 564.01 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-chloro-4-(dimethylamino)-8-[1-(2-fluoroethyl)pyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5CCF)c(Cl)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C27H31ClFN3O7/c1-31(2)21-14-9-11-8-13-18(16(33)10-12(20(13)28)15-4-3-6-32(15)7-5-29)22(34)17(11)24(36)27(14,39)25(37)19(23(21)35)26(30)38/h10-11,14-15,21,33-34,37,39H,3-9H2,1-2H3,(H2,30,38)/t11-,14-,15?,21-,27-/m0/s1 |
| InChIKey | MMKLUUZZMMWUME-NLAVPISJSA-N |
| XLogP | 1.72 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.01 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|