C32H41N3O8 — CID 167335825
(4S,4aS,5aR,12aR)-4-amino-8-[(2S)-1-cyclooctylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167335825) has the molecular formula C32H41N3O8 and a molecular weight of 595.69 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-amino-8-[(2S)-1-cyclooctylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-amino-8-[(2S)-1-cyclooctylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167335825 |
| Molecular Formula | C32H41N3O8 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-amino-8-[(2S)-1-cyclooctylpyrrolidin-2-yl]-1,10,11,12a-tetrahydroxy-7-methoxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1c([C@@H]2CCCN2C2CCCCCCC2)cc(O)c2c1C[C@H]1C[C@H]3[C@H](N)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H41N3O8/c1-43-28-17(20-10-7-11-35(20)16-8-5-3-2-4-6-9-16)14-21(36)23-18(28)12-15-13-19-25(33)27(38)24(31(34)41)30(40)32(19,42)29(39)22(15)26(23)37/h14-16,19-20,25,36-37,40,42H,2-13,33H2,1H3,(H2,34,41)/t15-,19-,20-,25-,32-/m0/s1 |
| InChIKey | AHXYQCVGXIRFIP-BXOJRISZSA-N |
| XLogP | 2.62 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|