C30H31FN4O6 — CID 137103792
(4S,4aS,5aR,12aR)-8-(1,3-dihydroisoindol-2-ylmethyl)-4-(dimethylamino)-7-fluoro-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137103792) has the molecular formula C30H31FN4O6 and a molecular weight of 562.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-(1,3-dihydroisoindol-2-ylmethyl)-4-(dimethylamino)-7-fluoro-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-(1,3-dihydroisoindol-2-ylmethyl)-4-(dimethylamino)-7-fluoro-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137103792 |
| Molecular Formula | C30H31FN4O6 |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-(1,3-dihydroisoindol-2-ylmethyl)-4-(dimethylamino)-7-fluoro-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(F)c(CN5Cc6ccccc6C5)cc(O)c4C(O)=C3C(=O)[C@]12O |
| InChI | InChI=1S/C30H31FN4O6/c1-34(2)24-18-8-15-7-17-21(25(37)20(15)28(39)30(18,41)27(32)22(26(24)38)29(33)40)19(36)9-16(23(17)31)12-35-10-13-5-3-4-6-14(13)11-35/h3-6,9,15,18,24,32,36-38,41H,7-8,10-12H2,1-2H3,(H2,33,40)/b32-27+/t15-,18-,24-,30+/m0/s1 |
| InChIKey | UCWLADZMSAQPEV-WJQCJWGVSA-N |
| XLogP | 2.07 |
| TPSA | 171.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|