C26H34N4O7 — CID 163586097
(4S,4aS,5aR,12aR)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-7-[[(2-methylpropan-2-yl)oxyamino]methyl]-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 163586097) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-7-[[(2-methylpropan-2-yl)oxyamino]methyl]-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-7-[[(2-methylpropan-2-yl)oxyamino]methyl]-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 163586097 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-7-[[(2-methylpropan-2-yl)oxyamino]methyl]-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(CNOC(C)(C)C)ccc(O)c4C(O)=C3C(=O)[C@]12O |
| InChI | InChI=1S/C26H34N4O7/c1-25(2,3)37-29-10-11-6-7-15(31)17-13(11)8-12-9-14-19(30(4)5)21(33)18(24(28)35)22(27)26(14,36)23(34)16(12)20(17)32/h6-7,12,14,19,27,29,31-33,36H,8-10H2,1-5H3,(H2,28,35)/b27-22+/t12-,14-,19-,26+/m0/s1 |
| InChIKey | ABAJZFZKUGMEFT-JFTAFEPNSA-N |
| XLogP | 1.23 |
| TPSA | 189.43 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|