C25H32N4O6 — CID 154474662
(4R,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-ethyl-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 154474662) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-ethyl-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-ethyl-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 154474662 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4,7-bis(dimethylamino)-9-ethyl-3,10,11,12a-tetrahydroxy-1-imino-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)[C@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(N(C)C)cc(CC)c(O)c4C(O)=C3C(=O)[C@]12O |
| InChI | InChI=1S/C25H32N4O6/c1-6-10-9-14(28(2)3)12-7-11-8-13-18(29(4)5)21(32)17(24(27)34)22(26)25(13,35)23(33)15(11)20(31)16(12)19(10)30/h9,11,13,18,26,30-32,35H,6-8H2,1-5H3,(H2,27,34)/b26-22+/t11-,13-,18+,25+/m0/s1 |
| InChIKey | WALIXXXKAGNVND-CMFUJUSTSA-N |
| XLogP | 1.04 |
| TPSA | 171.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|