C22H25N3O6 — CID 143709457
(4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-9-methyl-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 143709457) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-9-methyl-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-9-methyl-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 143709457 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (4aS,5aR,12aR)-7-(dimethylamino)-3,10,11,12a-tetrahydroxy-1-imino-9-methyl-12-oxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | [H]/N=C1\C(C(N)=O)=C(O)C[C@@H]2C[C@@H]3Cc4c(N(C)C)cc(C)c(O)c4C(O)=C3C(=O)[C@]12O |
| InChI | InChI=1S/C22H25N3O6/c1-8-4-12(25(2)3)11-6-9-5-10-7-13(26)16(21(24)30)19(23)22(10,31)20(29)14(9)18(28)15(11)17(8)27/h4,9-10,23,26-28,31H,5-7H2,1-3H3,(H2,24,30)/b23-19+/t9-,10+,22-/m1/s1 |
| InChIKey | CQDIFPYNWYHIBY-OALBHOIHSA-N |
| XLogP | 1.25 |
| TPSA | 168.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|