C23H23FN2O7 — CID 138509419
(4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-pyrrolidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 138509419) has the molecular formula C23H23FN2O7 and a molecular weight of 458.44 g/mol. Its IUPAC name is (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-pyrrolidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-pyrrolidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 138509419 |
| Molecular Formula | C23H23FN2O7 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-8-pyrrolidin-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5)c(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C23H23FN2O7/c24-18-10(12-2-1-3-26-12)7-14(28)16-11(18)5-8-4-9-6-13(27)17(22(25)32)21(31)23(9,33)20(30)15(8)19(16)29/h7-9,12,26,28-29,31,33H,1-6H2,(H2,25,32)/t8?,9-,12?,23-/m0/s1 |
| InChIKey | GMPUOPXODXOJEZ-HZGCCEGOSA-N |
| XLogP | 0.99 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|