C23H24FNO6 — CID 138509315
(4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-9-pyrrolidin-2-yl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 138509315) has the molecular formula C23H24FNO6 and a molecular weight of 429.44 g/mol. Its IUPAC name is (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-9-pyrrolidin-2-yl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-9-pyrrolidin-2-yl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 138509315 |
| Molecular Formula | C23H24FNO6 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-9-pyrrolidin-2-yl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cc(C5CCCN5)c(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C23H24FNO6/c1-9-15(26)7-11-5-10-6-13-18(20(28)17(10)22(30)23(11,31)21(9)29)16(27)8-12(19(13)24)14-3-2-4-25-14/h8,10-11,14,25,27-29,31H,2-7H2,1H3/t10?,11-,14?,23+/m0/s1 |
| InChIKey | ZFVNWRBHDIAWPW-ASGLOOEHSA-N |
| XLogP | 2.52 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |