C20H20FNO6 — CID 138509366
(4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-8-(methylamino)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 138509366) has the molecular formula C20H20FNO6 and a molecular weight of 389.38 g/mol. Its IUPAC name is (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-8-(methylamino)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-8-(methylamino)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 138509366 |
| Molecular Formula | C20H20FNO6 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (4aR,12aS)-10-fluoro-4,4a,6,7-tetrahydroxy-3-methyl-8-(methylamino)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CNc1cc(F)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C)C(=O)C[C@@H]3CC1C2 |
| InChI | InChI=1S/C20H20FNO6/c1-7-13(23)5-9-3-8-4-10-11(21)6-12(22-2)16(24)15(10)17(25)14(8)19(27)20(9,28)18(7)26/h6,8-9,22,24-26,28H,3-5H2,1-2H3/t8?,9-,20+/m0/s1 |
| InChIKey | WDKGTGKTNDKUOZ-VYVWOWTISA-N |
| XLogP | 2.14 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|