C28H32FN3O8 — CID 130468012
(4aS,12aR)-9-[[2-(cyclohexylmethylamino)acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 130468012) has the molecular formula C28H32FN3O8 and a molecular weight of 557.58 g/mol. Its IUPAC name is (4aS,12aR)-9-[[2-(cyclohexylmethylamino)acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-9-[[2-(cyclohexylmethylamino)acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 130468012 |
| Molecular Formula | C28H32FN3O8 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (4aS,12aR)-9-[[2-(cyclohexylmethylamino)acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)CNCC5CCCCC5)cc(F)c4CC3C[C@H]2CC1=O |
| InChI | InChI=1S/C28H32FN3O8/c29-16-9-17(32-19(34)11-31-10-12-4-2-1-3-5-12)23(35)21-15(16)7-13-6-14-8-18(33)22(27(30)39)26(38)28(14,40)25(37)20(13)24(21)36/h9,12-14,31,35-36,38,40H,1-8,10-11H2,(H2,30,39)(H,32,34)/t13?,14-,28-/m0/s1 |
| InChIKey | CLRVHEDJEQBQJW-PAOASCBESA-N |
| XLogP | 1.67 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|