C29H34FN3O8 — CID 148737516
(4S,4aS,5aR,12aR)-9-(3-cyclopentylpropanoylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 148737516) has the molecular formula C29H34FN3O8 and a molecular weight of 571.60 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-(3-cyclopentylpropanoylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-(3-cyclopentylpropanoylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 148737516 |
| Molecular Formula | C29H34FN3O8 |
| Molecular Weight | 571.60 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-(3-cyclopentylpropanoylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)CCC5CCCC5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C29H34FN3O8/c1-33(2)22-15-10-13-9-14-16(30)11-17(32-18(34)8-7-12-5-3-4-6-12)23(35)20(14)24(36)19(13)26(38)29(15,41)27(39)21(25(22)37)28(31)40/h11-13,15,22,35-36,39,41H,3-10H2,1-2H3,(H2,31,40)(H,32,34)/t13-,15-,22-,29-/m0/s1 |
| InChIKey | BAFBJIARFKTLQM-WOTXACPJSA-N |
| XLogP | 2.01 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|