C28H32FN3O8 — CID 153170656
(4S,4aS,5aR,12aR)-9-(cyclohexanecarbonylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 153170656) has the molecular formula C28H32FN3O8 and a molecular weight of 557.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-(cyclohexanecarbonylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-(cyclohexanecarbonylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 153170656 |
| Molecular Formula | C28H32FN3O8 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-(cyclohexanecarbonylamino)-4-(dimethylamino)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)C5CCCCC5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H32FN3O8/c1-32(2)20-14-9-12-8-13-15(29)10-16(31-27(39)11-6-4-3-5-7-11)21(33)18(13)22(34)17(12)24(36)28(14,40)25(37)19(23(20)35)26(30)38/h10-12,14,20,33-34,37,40H,3-9H2,1-2H3,(H2,30,38)(H,31,39)/t12-,14-,20-,28-/m0/s1 |
| InChIKey | LHJXNXNXXIFYBJ-STQWUWILSA-N |
| XLogP | 1.62 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|