C30H39N5O8 — CID 54751532
N-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide (PubChem CID 54751532) has the molecular formula C30H39N5O8 and a molecular weight of 597.67 g/mol. Its IUPAC name is N-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide.
| Compound Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 54751532 |
| Molecular Formula | C30H39N5O8 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | N-[(5aR,6aS,7S,10aR)-9-carbamoyl-4,7-bis(dimethylamino)-1,10,10a,12-tetrahydroxy-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-1-methylpiperidine-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)C2CCCCN2C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H39N5O8/c1-33(2)18-12-16(32-29(42)17-8-6-7-9-35(17)5)23(36)20-14(18)10-13-11-15-22(34(3)4)25(38)21(28(31)41)27(40)30(15,43)26(39)19(13)24(20)37/h12-13,15,17,22,36-37,40,43H,6-11H2,1-5H3,(H2,31,41)(H,32,42)/t13-,15-,17?,22-,30-/m0/s1 |
| InChIKey | VOVFNCCNKARQKV-LMFGTIGASA-N |
| XLogP | 0.45 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|