C26H27F4N3O8 — CID 130468033
(4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-propan-2-yl-9-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 130468033) has the molecular formula C26H27F4N3O8 and a molecular weight of 585.51 g/mol. Its IUPAC name is (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-propan-2-yl-9-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-propan-2-yl-9-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 130468033 |
| Molecular Formula | C26H27F4N3O8 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | (4aS,12aR)-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4-propan-2-yl-9-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)C1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(NC(=O)CNCC(F)(F)F)cc(F)c4CC3C[C@@H]12 |
| InChI | InChI=1S/C26H27F4N3O8/c1-8(2)15-11-4-9-3-10-12(27)5-13(33-14(34)6-32-7-25(28,29)30)19(35)17(10)21(37)16(9)22(38)26(11,41)23(39)18(20(15)36)24(31)40/h5,8-9,11,15,32,35,37,39,41H,3-4,6-7H2,1-2H3,(H2,31,40)(H,33,34)/t9?,11-,15?,26-/m0/s1 |
| InChIKey | ONGBDIMYKQKIDE-QSFYJEQPSA-N |
| XLogP | 1.54 |
| TPSA | 199.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|