C25H31N5O8 — CID 89327838
(4S,12aR)-4,7-diamino-9-[[2-(tert-butylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 89327838) has the molecular formula C25H31N5O8 and a molecular weight of 529.55 g/mol. Its IUPAC name is (4S,12aR)-4,7-diamino-9-[[2-(tert-butylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-diamino-9-[[2-(tert-butylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 89327838 |
| Molecular Formula | C25H31N5O8 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | (4S,12aR)-4,7-diamino-9-[[2-(tert-butylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)NCC(=O)Nc1cc(N)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N)C3CC1C2 |
| InChI | InChI=1S/C25H31N5O8/c1-24(2,3)29-7-13(31)30-12-6-11(26)9-4-8-5-10-17(27)20(34)16(23(28)37)22(36)25(10,38)21(35)14(8)19(33)15(9)18(12)32/h6,8,10,17,29,32-33,36,38H,4-5,7,26-27H2,1-3H3,(H2,28,37)(H,30,31)/t8?,10?,17-,25-/m0/s1 |
| InChIKey | QGGVFGNKOXTNJY-XOBVSFGISA-N |
| XLogP | -0.73 |
| TPSA | 251.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|