C24H27FN4O8 — CID 167336042
(4R,4aS,5aR,12aR)-4-amino-9-[[2-[ethyl(methyl)amino]acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167336042) has the molecular formula C24H27FN4O8 and a molecular weight of 518.50 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-amino-9-[[2-[ethyl(methyl)amino]acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-amino-9-[[2-[ethyl(methyl)amino]acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167336042 |
| Molecular Formula | C24H27FN4O8 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-amino-9-[[2-[ethyl(methyl)amino]acetyl]amino]-7-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(C)CC(=O)Nc1cc(F)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@H](N)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H27FN4O8/c1-3-29(2)7-13(30)28-12-6-11(25)9-4-8-5-10-17(26)20(33)16(23(27)36)22(35)24(10,37)21(34)14(8)19(32)15(9)18(12)31/h6,8,10,17,31-32,35,37H,3-5,7,26H2,1-2H3,(H2,27,36)(H,28,30)/t8-,10-,17+,24-/m0/s1 |
| InChIKey | GUZMHPCWLFCAEH-ZRUMIJPVSA-N |
| XLogP | -0.61 |
| TPSA | 216.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|