C20H22N4O8 — CID 118656041
(4R,4aS,5aR,12aR)-7,9-diamino-1,10,11,12a-tetrahydroxy-4-(hydroxymethylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118656041) has the molecular formula C20H22N4O8 and a molecular weight of 446.42 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-7,9-diamino-1,10,11,12a-tetrahydroxy-4-(hydroxymethylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-7,9-diamino-1,10,11,12a-tetrahydroxy-4-(hydroxymethylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118656041 |
| Molecular Formula | C20H22N4O8 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (4R,4aS,5aR,12aR)-7,9-diamino-1,10,11,12a-tetrahydroxy-4-(hydroxymethylamino)-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(N)cc(N)c4C[C@H]3C[C@H]2[C@@H](NCO)C1=O |
| InChI | InChI=1S/C20H22N4O8/c21-8-3-9(22)14(26)11-6(8)1-5-2-7-13(24-4-25)16(28)12(19(23)31)18(30)20(7,32)17(29)10(5)15(11)27/h3,5,7,13,24-27,30,32H,1-2,4,21-22H2,(H2,23,31)/t5-,7-,13+,20-/m0/s1 |
| InChIKey | IPDQWPAJTMEYAN-ZYDXKERPSA-N |
| XLogP | -1.89 |
| TPSA | 242.45 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|