C22H21F3N2O7 — CID 167336068
(4S,4aS,5aR,12aR)-4-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 167336068) has the molecular formula C22H21F3N2O7 and a molecular weight of 482.41 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 167336068 |
| Molecular Formula | C22H21F3N2O7 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(trifluoromethyl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C(F)(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H21F3N2O7/c1-2-27-15-10-6-7-5-8-9(22(23,24)25)3-4-11(28)13(8)16(29)12(7)18(31)21(10,34)19(32)14(17(15)30)20(26)33/h3-4,7,10,15,27-29,32,34H,2,5-6H2,1H3,(H2,26,33)/t7-,10-,15-,21-/m0/s1 |
| InChIKey | ANOZCFDMPRDOES-BQRXHRJWSA-N |
| XLogP | 1.03 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|