C20H21NO7 — CID 145466837
(4aR,12aS)-4,4a,6,7-tetrahydroxy-3-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;formamide (PubChem CID 145466837) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is (4aR,12aS)-4,4a,6,7-tetrahydroxy-3-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;formamide.
| Compound Name | (4aR,12aS)-4,4a,6,7-tetrahydroxy-3-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;formamide |
|---|---|
| PubChem CID | 145466837 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (4aR,12aS)-4,4a,6,7-tetrahydroxy-3-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione;formamide |
| SMILES | CC1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4CC3C[C@H]2CC1=O.NC=O |
| InChI | InChI=1S/C19H18O6.CH3NO/c1-8-13(21)7-11-6-10-5-9-3-2-4-12(20)14(9)16(22)15(10)18(24)19(11,25)17(8)23;2-1-3/h2-4,10-11,20,22-23,25H,5-7H2,1H3;1H,(H2,2,3)/t10?,11-,19+;/m0./s1 |
| InChIKey | NMLMCQCVASTJFN-BZZPMTHJSA-N |
| XLogP | 1.06 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|