C23H23NO9 — CID 58647918
ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate (PubChem CID 58647918) has the molecular formula C23H23NO9 and a molecular weight of 457.44 g/mol. Its IUPAC name is ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate.
| Compound Name | ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 58647918 |
| Molecular Formula | C23H23NO9 |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | ethyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
| SMILES | CCOC(=O)COC1=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C[C@H]3C[C@H]2C1 |
| InChI | InChI=1S/C23H23NO9/c1-2-32-15(26)9-33-14-8-12-7-11-6-10-4-3-5-13(25)16(10)19(27)17(11)20(28)23(12,31)21(29)18(14)22(24)30/h3-5,11-12,25,27,31H,2,6-9H2,1H3,(H2,24,30)/t11-,12-,23-/m0/s1 |
| InChIKey | ODZXOSBUPNMKST-RSPIHXBNSA-N |
| XLogP | 0.45 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|