C20H21NO6 — CID 122505247
2-(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a,6-tetrahydro-4H-tetracene-1,3,12-trione (PubChem CID 122505247) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a,6-tetrahydro-4H-tetracene-1,3,12-trione.
| Compound Name | 2-(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a,6-tetrahydro-4H-tetracene-1,3,12-trione |
|---|---|
| PubChem CID | 122505247 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(dimethylamino)-10,11,12a-trihydroxy-4a,5,5a,6-tetrahydro-4H-tetracene-1,3,12-trione |
| SMILES | CN(C)C1C(=O)CC2CC3Cc4cccc(O)c4C(O)=C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C20H21NO6/c1-21(2)16-13(23)8-11-7-10-6-9-4-3-5-12(22)14(9)17(24)15(10)18(25)20(11,27)19(16)26/h3-5,10-11,16,22,24,27H,6-8H2,1-2H3 |
| InChIKey | AXBMGSHWFSKYBQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|