C19H15NO7 — CID 58437175
CID 58437175 (PubChem CID 58437175) has the molecular formula C19H15NO7 and a molecular weight of 369.33 g/mol.
| Compound Name | CID 58437175 |
|---|---|
| PubChem CID | 58437175 |
| Molecular Formula | C19H15NO7 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | — |
| SMILES | [N]C(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4CC3CC2CC1=O |
| InChI | InChI=1S/C19H15NO7/c20-18(26)14-11(22)6-9-5-8-4-7-2-1-3-10(21)12(7)15(23)13(8)16(24)19(9,27)17(14)25/h1-3,8-9,21,23,25,27H,4-6H2/t8?,9?,19-/m0/s1 |
| InChIKey | QIKCHAXEOHNVMJ-LANRQRAVSA-N |
| XLogP | 0.53 |
| TPSA | 154.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|