C19H17NO9 — CID 163444848
1,6,6,10,11,12a-hexahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 163444848) has the molecular formula C19H17NO9 and a molecular weight of 403.34 g/mol. Its IUPAC name is 1,6,6,10,11,12a-hexahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | 1,6,6,10,11,12a-hexahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 163444848 |
| Molecular Formula | C19H17NO9 |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 1,6,6,10,11,12a-hexahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(O)(O)C3CC2CC1=O |
| InChI | InChI=1S/C19H17NO9/c20-17(26)13-10(22)5-6-4-8-12(15(24)18(6,27)16(13)25)14(23)11-7(19(8,28)29)2-1-3-9(11)21/h1-3,6,8,21,23,25,27-29H,4-5H2,(H2,20,26) |
| InChIKey | WSMJBTQRCCQPSQ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 198.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|