C21H21NO7 — CID 54739271
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-6,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 54739271) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-6,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-6,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54739271 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-6,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CC1(C)c2cccc(O)c2C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C21H21NO7/c1-20(2)9-4-3-5-11(23)13(9)16(25)14-10(20)6-8-7-12(24)15(19(22)28)18(27)21(8,29)17(14)26/h3-5,8,10,23,25,27,29H,6-7H2,1-2H3,(H2,22,28)/t8-,10-,21-/m0/s1 |
| InChIKey | YOZUWHKFASIBRJ-AJHYNDKWSA-N |
| XLogP | 1.16 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|