C24H22O8 — CID 122680464
(4aR,11aR,12aS)-3-acetyl-4,4a,6,7-tetrahydroxy-10-(3-hydroxybut-1-ynyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 122680464) has the molecular formula C24H22O8 and a molecular weight of 438.43 g/mol. Its IUPAC name is (4aR,11aR,12aS)-3-acetyl-4,4a,6,7-tetrahydroxy-10-(3-hydroxybut-1-ynyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aR,11aR,12aS)-3-acetyl-4,4a,6,7-tetrahydroxy-10-(3-hydroxybut-1-ynyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 122680464 |
| Molecular Formula | C24H22O8 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (4aR,11aR,12aS)-3-acetyl-4,4a,6,7-tetrahydroxy-10-(3-hydroxybut-1-ynyl)-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C#CC(C)O)c4C[C@H]3C[C@H]2CC1=O |
| InChI | InChI=1S/C24H22O8/c1-10(25)3-4-12-5-6-16(27)20-15(12)8-13-7-14-9-17(28)18(11(2)26)22(30)24(14,32)23(31)19(13)21(20)29/h5-6,10,13-14,25,27,29-30,32H,7-9H2,1-2H3/t10?,13-,14+,24-/m1/s1 |
| InChIKey | JTXATDWRQPVWKW-OICGBWSWSA-N |
| XLogP | 1.26 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|