C22H20O8 — CID 122680006
(4aS,11aS,12aR)-3,10-diacetyl-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 122680006) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is (4aS,11aS,12aR)-3,10-diacetyl-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aS,11aS,12aR)-3,10-diacetyl-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 122680006 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (4aS,11aS,12aR)-3,10-diacetyl-4,4a,6,7-tetrahydroxy-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CC(=O)C1=C(O)[C@]2(O)C(=O)C3=C(O)c4c(O)ccc(C(C)=O)c4C[C@@H]3C[C@@H]2CC1=O |
| InChI | InChI=1S/C22H20O8/c1-8(23)12-3-4-14(25)18-13(12)6-10-5-11-7-15(26)16(9(2)24)20(28)22(11,30)21(29)17(10)19(18)27/h3-4,10-11,25,27-28,30H,5-7H2,1-2H3/t10-,11+,22-/m0/s1 |
| InChIKey | SOHBCHHMWNAMER-UTSGRSJNSA-N |
| XLogP | 1.73 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|