C22H21NO9 — CID 122680341
methyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate (PubChem CID 122680341) has the molecular formula C22H21NO9 and a molecular weight of 443.41 g/mol. Its IUPAC name is methyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate.
| Compound Name | methyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 122680341 |
| Molecular Formula | C22H21NO9 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | methyl 2-[[(4aS,11aR,12aS)-3-carbamoyl-4a,6,7-trihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl]oxy]acetate |
| SMILES | COC(=O)COC1=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4C[C@H]3C[C@H]2C1 |
| InChI | InChI=1S/C22H21NO9/c1-31-14(25)8-32-13-7-11-6-10-5-9-3-2-4-12(24)15(9)18(26)16(10)19(27)22(11,30)20(28)17(13)21(23)29/h2-4,10-11,24,26,30H,5-8H2,1H3,(H2,23,29)/t10-,11-,22-/m0/s1 |
| InChIKey | FCQGCNYKCYNMGU-GANBNBROSA-N |
| XLogP | 0.06 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|